C24H16ClIN2O5 — CID 126236856
4-[[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid (PubChem CID 126236856) has the molecular formula C24H16ClIN2O5 and a molecular weight of 574.76 g/mol. Its IUPAC name is 4-[[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126236856 |
| Molecular Formula | C24H16ClIN2O5 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 573.98 |
| IUPAC Name | 4-[[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc(/C=C3/NC(=O)N(c4ccc(Cl)cc4)C3=O)cc2I)cc1 |
| InChI | InChI=1S/C24H16ClIN2O5/c25-17-6-8-18(9-7-17)28-22(29)20(27-24(28)32)12-15-3-10-21(19(26)11-15)33-13-14-1-4-16(5-2-14)23(30)31/h1-12H,13H2,(H,27,32)(H,30,31)/b20-12+ |
| InChIKey | FDWKLSKFBINTGF-UDWIEESQSA-N |
| XLogP | 5.32 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|