C19H14ClIN2O5 — CID 126180284
methyl 2-[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate (PubChem CID 126180284) has the molecular formula C19H14ClIN2O5 and a molecular weight of 512.69 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126180284 |
| Molecular Formula | C19H14ClIN2O5 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | methyl 2-[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc1I |
| InChI | InChI=1S/C19H14ClIN2O5/c1-27-17(24)10-28-16-7-2-11(8-14(16)21)9-15-18(25)23(19(26)22-15)13-5-3-12(20)4-6-13/h2-9H,10H2,1H3,(H,22,26)/b15-9+ |
| InChIKey | PKVUZHMTRNLGOK-OQLLNIDSSA-N |
| XLogP | 3.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|