C19H13ClINO5S — CID 126224379
methyl 2-[4-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate (PubChem CID 126224379) has the molecular formula C19H13ClINO5S and a molecular weight of 529.74 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126224379 |
| Molecular Formula | C19H13ClINO5S |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 528.92 |
| IUPAC Name | methyl 2-[4-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2/SC(=O)N(c3cccc(Cl)c3)C2=O)cc1I |
| InChI | InChI=1S/C19H13ClINO5S/c1-26-17(23)10-27-15-6-5-11(7-14(15)21)8-16-18(24)22(19(25)28-16)13-4-2-3-12(20)9-13/h2-9H,10H2,1H3/b16-8+ |
| InChIKey | SXVDDADWBKJAEY-LZYBPNLTSA-N |
| XLogP | 4.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|