C20H14ClI2NO5S — CID 126221679
ethyl 2-[4-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetate (PubChem CID 126221679) has the molecular formula C20H14ClI2NO5S and a molecular weight of 669.66 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetate |
|---|---|
| PubChem CID | 126221679 |
| Molecular Formula | C20H14ClI2NO5S |
| Molecular Weight | 669.66 g/mol |
| Exact Mass | 668.84 |
| IUPAC Name | ethyl 2-[4-[(E)-[3-(3-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,6-diiodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=C2/SC(=O)N(c3cccc(Cl)c3)C2=O)cc1I |
| InChI | InChI=1S/C20H14ClI2NO5S/c1-2-28-17(25)10-29-18-14(22)6-11(7-15(18)23)8-16-19(26)24(20(27)30-16)13-5-3-4-12(21)9-13/h3-9H,2,10H2,1H3/b16-8+ |
| InChIKey | ZRFKXVCVNDWSDJ-LZYBPNLTSA-N |
| XLogP | 5.73 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|