C23H13Cl3INO3S — CID 126215030
(5E)-3-(3-chlorophenyl)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126215030) has the molecular formula C23H13Cl3INO3S and a molecular weight of 616.69 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chlorophenyl)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126215030 |
| Molecular Formula | C23H13Cl3INO3S |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 614.87 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-iodophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(OCc3ccc(Cl)cc3Cl)c(I)c2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H13Cl3INO3S/c24-15-2-1-3-17(10-15)28-22(29)21(32-23(28)30)9-13-4-7-20(19(27)8-13)31-12-14-5-6-16(25)11-18(14)26/h1-11H,12H2/b21-9+ |
| InChIKey | CILYMGBRAUCVQZ-ZVBGSRNCSA-N |
| XLogP | 8.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|