C27H23Cl3N2O3S — CID 126281260
(5Z)-3-(3-chlorophenyl)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126281260) has the molecular formula C27H23Cl3N2O3S and a molecular weight of 561.92 g/mol. Its IUPAC name is (5Z)-3-(3-chlorophenyl)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(3-chlorophenyl)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126281260 |
| Molecular Formula | C27H23Cl3N2O3S |
| Molecular Weight | 561.92 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | (5Z)-3-(3-chlorophenyl)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCN(CC)c1ccc(/C=C2\SC(=O)N(c3cccc(Cl)c3)C2=O)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C27H23Cl3N2O3S/c1-3-31(4-2)21-11-9-17(24(15-21)35-16-18-8-10-20(29)14-23(18)30)12-25-26(33)32(27(34)36-25)22-7-5-6-19(28)13-22/h5-15H,3-4,16H2,1-2H3/b25-12- |
| InChIKey | YIHQIWHBRLSNAQ-ROTLSHHCSA-N |
| XLogP | 8.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.92 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|