C28H26Cl2N2O3S — CID 124666000
(5E)-3-[(2,6-dichlorophenyl)methyl]-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124666000) has the molecular formula C28H26Cl2N2O3S and a molecular weight of 541.50 g/mol. Its IUPAC name is (5E)-3-[(2,6-dichlorophenyl)methyl]-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2,6-dichlorophenyl)methyl]-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124666000 |
| Molecular Formula | C28H26Cl2N2O3S |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | (5E)-3-[(2,6-dichlorophenyl)methyl]-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=O)N(Cc3c(Cl)cccc3Cl)C2=O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H26Cl2N2O3S/c1-3-31(4-2)21-14-13-20(25(16-21)35-18-19-9-6-5-7-10-19)15-26-27(33)32(28(34)36-26)17-22-23(29)11-8-12-24(22)30/h5-16H,3-4,17-18H2,1-2H3/b26-15+ |
| InChIKey | RPBJRLVAUGGWIZ-CVKSISIWSA-N |
| XLogP | 7.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|