C33H31N3O4S — CID 126282398
2-[(5E)-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide (PubChem CID 126282398) has the molecular formula C33H31N3O4S and a molecular weight of 565.70 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(5E)-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126282398 |
| Molecular Formula | C33H31N3O4S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 2-[(5E)-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-naphthalen-1-ylacetamide |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=O)N(CC(=O)Nc3cccc4ccccc34)C2=O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H31N3O4S/c1-3-35(4-2)26-18-17-25(29(20-26)40-22-23-11-6-5-7-12-23)19-30-32(38)36(33(39)41-30)21-31(37)34-28-16-10-14-24-13-8-9-15-27(24)28/h5-20H,3-4,21-22H2,1-2H3,(H,34,37)/b30-19+ |
| InChIKey | ZCTMUTOETPWNOY-NDZAJKAJSA-N |
| XLogP | 6.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|