C31H33N3O4S — CID 126283273
2-[(5E)-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126283273) has the molecular formula C31H33N3O4S and a molecular weight of 543.69 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126283273 |
| Molecular Formula | C31H33N3O4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2-[(5E)-5-[[4-(diethylamino)-2-phenylmethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(C)c3C)C2=O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H33N3O4S/c1-5-33(6-2)25-16-15-24(27(18-25)38-20-23-12-8-7-9-13-23)17-28-30(36)34(31(37)39-28)19-29(35)32-26-14-10-11-21(3)22(26)4/h7-18H,5-6,19-20H2,1-4H3,(H,32,35)/b28-17+ |
| InChIKey | ZEAFJTSZMRJIFY-OGLMXYFKSA-N |
| XLogP | 6.40 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|