C32H33Cl2N3O4S — CID 3486813
2-[5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 3486813) has the molecular formula C32H33Cl2N3O4S and a molecular weight of 626.61 g/mol. Its IUPAC name is 2-[5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 3486813 |
| Molecular Formula | C32H33Cl2N3O4S |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | 2-[5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCN(CC)c1ccc(C=C2SC(=O)N(CC(=O)Nc3c(C)cc(C)cc3C)C2=O)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C32H33Cl2N3O4S/c1-6-36(7-2)25-11-9-22(27(16-25)41-18-23-8-10-24(33)15-26(23)34)14-28-31(39)37(32(40)42-28)17-29(38)35-30-20(4)12-19(3)13-21(30)5/h8-16H,6-7,17-18H2,1-5H3,(H,35,38) |
| InChIKey | XLHWLTYBAVFOIL-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|