C21H19ClFNO4S — CID 1498946
(5E)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2,4-diethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1498946) has the molecular formula C21H19ClFNO4S and a molecular weight of 435.90 g/mol. Its IUPAC name is (5E)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2,4-diethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2,4-diethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1498946 |
| Molecular Formula | C21H19ClFNO4S |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | (5E)-3-[(2-chloro-6-fluorophenyl)methyl]-5-[(2,4-diethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1ccc(/C=C2/SC(=O)N(Cc3c(F)cccc3Cl)C2=O)c(OCC)c1 |
| InChI | InChI=1S/C21H19ClFNO4S/c1-3-27-14-9-8-13(18(11-14)28-4-2)10-19-20(25)24(21(26)29-19)12-15-16(22)6-5-7-17(15)23/h5-11H,3-4,12H2,1-2H3/b19-10+ |
| InChIKey | RBZOSXJXJXOCLC-VXLYETTFSA-N |
| XLogP | 5.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|