C29H28N4O6S — CID 124662958
2-[2-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-5-(diethylamino)phenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 124662958) has the molecular formula C29H28N4O6S and a molecular weight of 560.63 g/mol. Its IUPAC name is 2-[2-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-5-(diethylamino)phenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[2-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-5-(diethylamino)phenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 124662958 |
| Molecular Formula | C29H28N4O6S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 2-[2-[(E)-(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-5-(diethylamino)phenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=O)N(Cc3ccccc3)C2=O)c(OCC(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C29H28N4O6S/c1-3-31(4-2)23-14-13-21(15-26-28(35)32(29(36)40-26)18-20-9-6-5-7-10-20)25(17-23)39-19-27(34)30-22-11-8-12-24(16-22)33(37)38/h5-17H,3-4,18-19H2,1-2H3,(H,30,34)/b26-15+ |
| InChIKey | GGWMFASAIILUDZ-CVKSISIWSA-N |
| XLogP | 5.70 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|