C33H35N5O7S — CID 126335048
2-[(5E)-5-[[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 126335048) has the molecular formula C33H35N5O7S and a molecular weight of 645.74 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126335048 |
| Molecular Formula | C33H35N5O7S |
| Molecular Weight | 645.74 g/mol |
| Exact Mass | 645.23 |
| IUPAC Name | 2-[(5E)-5-[[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(C(C)C)cc3)C2=O)c(OCC(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C33H35N5O7S/c1-5-36(6-2)26-15-12-23(28(18-26)45-20-31(40)35-25-8-7-9-27(17-25)38(43)44)16-29-32(41)37(33(42)46-29)19-30(39)34-24-13-10-22(11-14-24)21(3)4/h7-18,21H,5-6,19-20H2,1-4H3,(H,34,39)(H,35,40)/b29-16+ |
| InChIKey | ACTWOROJBLJJOO-MUFRIFMGSA-N |
| XLogP | 6.26 |
| TPSA | 151.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.74 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|