C30H27ClN4O7S — CID 126255181
2-[2-[(E)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-5-(diethylamino)phenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126255181) has the molecular formula C30H27ClN4O7S and a molecular weight of 623.09 g/mol. Its IUPAC name is 2-[2-[(E)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-5-(diethylamino)phenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[2-[(E)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-5-(diethylamino)phenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126255181 |
| Molecular Formula | C30H27ClN4O7S |
| Molecular Weight | 623.09 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | 2-[2-[(E)-[3-[2-(4-chlorophenyl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-5-(diethylamino)phenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=O)N(CC(=O)c3ccc(Cl)cc3)C2=O)c(OCC(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C30H27ClN4O7S/c1-3-33(4-2)23-13-10-20(26(16-23)42-18-28(37)32-22-6-5-7-24(15-22)35(40)41)14-27-29(38)34(30(39)43-27)17-25(36)19-8-11-21(31)12-9-19/h5-16H,3-4,17-18H2,1-2H3,(H,32,37)/b27-14+ |
| InChIKey | IBVDFDJIPVEULW-MZJWZYIUSA-N |
| XLogP | 6.03 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.09 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|