C22H23N5O5 — CID 126069486
(E)-2-cyano-3-[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]prop-2-enamide (PubChem CID 126069486) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126069486 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (E)-2-cyano-3-[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(/C=C(\C#N)C(N)=O)c(OCC(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H23N5O5/c1-3-26(4-2)18-9-8-15(10-16(13-23)22(24)29)20(12-18)32-14-21(28)25-17-6-5-7-19(11-17)27(30)31/h5-12H,3-4,14H2,1-2H3,(H2,24,29)(H,25,28)/b16-10+ |
| InChIKey | GYSJCJSOUFOZOX-MHWRWJLKSA-N |
| XLogP | 2.85 |
| TPSA | 151.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|