C20H15Br2ClN2O5 — CID 126180679
ethyl 2-[2,6-dibromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126180679) has the molecular formula C20H15Br2ClN2O5 and a molecular weight of 558.61 g/mol. Its IUPAC name is ethyl 2-[2,6-dibromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dibromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126180679 |
| Molecular Formula | C20H15Br2ClN2O5 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 555.90 |
| IUPAC Name | ethyl 2-[2,6-dibromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc1Br |
| InChI | InChI=1S/C20H15Br2ClN2O5/c1-2-29-17(26)10-30-18-14(21)7-11(8-15(18)22)9-16-19(27)25(20(28)24-16)13-5-3-12(23)4-6-13/h3-9H,2,10H2,1H3,(H,24,28)/b16-9+ |
| InChIKey | SBAVYCAPMQHLJO-CXUHLZMHSA-N |
| XLogP | 4.90 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|