C18H14ClIN2O4 — CID 126173764
(5E)-3-(4-chlorophenyl)-5-[(3-iodo-4,5-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 126173764) has the molecular formula C18H14ClIN2O4 and a molecular weight of 484.68 g/mol. Its IUPAC name is (5E)-3-(4-chlorophenyl)-5-[(3-iodo-4,5-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(4-chlorophenyl)-5-[(3-iodo-4,5-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126173764 |
| Molecular Formula | C18H14ClIN2O4 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 483.97 |
| IUPAC Name | (5E)-3-(4-chlorophenyl)-5-[(3-iodo-4,5-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc(I)c1OC |
| InChI | InChI=1S/C18H14ClIN2O4/c1-25-15-9-10(7-13(20)16(15)26-2)8-14-17(23)22(18(24)21-14)12-5-3-11(19)4-6-12/h3-9H,1-2H3,(H,21,24)/b14-8+ |
| InChIKey | MKHHYJAZFHQWDU-RIYZIHGNSA-N |
| XLogP | 4.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|