C24H18ClIN2O3 — CID 126082357
(5E)-3-(3-chlorophenyl)-5-[[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126082357) has the molecular formula C24H18ClIN2O3 and a molecular weight of 544.78 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-5-[[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chlorophenyl)-5-[[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126082357 |
| Molecular Formula | C24H18ClIN2O3 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.01 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-5-[[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(COc2ccc(/C=C3/NC(=O)N(c4cccc(Cl)c4)C3=O)cc2I)c1 |
| InChI | InChI=1S/C24H18ClIN2O3/c1-15-4-2-5-17(10-15)14-31-22-9-8-16(11-20(22)26)12-21-23(29)28(24(30)27-21)19-7-3-6-18(25)13-19/h2-13H,14H2,1H3,(H,27,30)/b21-12+ |
| InChIKey | WCWDHZFQHNLQDZ-CIAFOILYSA-N |
| XLogP | 5.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|