C20H18ClFN2O2S — CID 126089154
(5Z)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126089154) has the molecular formula C20H18ClFN2O2S and a molecular weight of 404.89 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126089154 |
| Molecular Formula | C20H18ClFN2O2S |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (5Z)-5-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2ccc(OCc3ccc(F)cc3)c(Cl)c2)NC1=S |
| InChI | InChI=1S/C20H18ClFN2O2S/c1-2-9-24-19(25)17(23-20(24)27)11-14-5-8-18(16(21)10-14)26-12-13-3-6-15(22)7-4-13/h3-8,10-11H,2,9,12H2,1H3,(H,23,27)/b17-11- |
| InChIKey | SVPLMQRQYUWITM-BOPFTXTBSA-N |
| XLogP | 4.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|