C19H14BrN3O2S — CID 126045390
2-[4-bromo-2-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetonitrile (PubChem CID 126045390) has the molecular formula C19H14BrN3O2S and a molecular weight of 428.31 g/mol. Its IUPAC name is 2-[4-bromo-2-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[4-bromo-2-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 126045390 |
| Molecular Formula | C19H14BrN3O2S |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 2-[4-bromo-2-[(Z)-(3-methyl-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetonitrile |
| SMILES | CN1C(=S)N(c2ccccc2)C(=O)/C1=C/c1cc(Br)ccc1OCC#N |
| InChI | InChI=1S/C19H14BrN3O2S/c1-22-16(12-13-11-14(20)7-8-17(13)25-10-9-21)18(24)23(19(22)26)15-5-3-2-4-6-15/h2-8,11-12H,10H2,1H3/b16-12- |
| InChIKey | GAYIKAXMZORDKV-VBKFSLOCSA-N |
| XLogP | 3.96 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|