C18H14Br2N2O3S — CID 126043660
(5Z)-5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126043660) has the molecular formula C18H14Br2N2O3S and a molecular weight of 498.20 g/mol. Its IUPAC name is (5Z)-5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126043660 |
| Molecular Formula | C18H14Br2N2O3S |
| Molecular Weight | 498.20 g/mol |
| Exact Mass | 495.91 |
| IUPAC Name | (5Z)-5-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(/C=C2/C(=O)N(c3ccccc3)C(=S)N2C)c(Br)c(Br)c1O |
| InChI | InChI=1S/C18H14Br2N2O3S/c1-21-12(8-10-9-13(25-2)16(23)15(20)14(10)19)17(24)22(18(21)26)11-6-4-3-5-7-11/h3-9,23H,1-2H3/b12-8- |
| InChIKey | STSRHNWQQAQKQR-WQLSENKSSA-N |
| XLogP | 4.53 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|