C14H11ClN2O4S2 — CID 18841551
4-amino-2-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-oxobutanoic acid (PubChem CID 18841551) has the molecular formula C14H11ClN2O4S2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 4-amino-2-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18841551 |
| Molecular Formula | C14H11ClN2O4S2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 4-amino-2-[(5Z)-5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(C(=O)O)N1C(=O)/C(=C/c2ccccc2Cl)SC1=S |
| InChI | InChI=1S/C14H11ClN2O4S2/c15-8-4-2-1-3-7(8)5-10-12(19)17(14(22)23-10)9(13(20)21)6-11(16)18/h1-5,9H,6H2,(H2,16,18)(H,20,21)/b10-5- |
| InChIKey | DRLUQZWJERWLFD-YHYXMXQVSA-N |
| XLogP | 1.87 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|