C14H11N3O6S2 — CID 18841570
4-amino-2-[(5Z)-5-[(3-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-oxobutanoic acid (PubChem CID 18841570) has the molecular formula C14H11N3O6S2 and a molecular weight of 381.39 g/mol. Its IUPAC name is 4-amino-2-[(5Z)-5-[(3-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(5Z)-5-[(3-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18841570 |
| Molecular Formula | C14H11N3O6S2 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 4-amino-2-[(5Z)-5-[(3-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(C(=O)O)N1C(=O)/C(=C/c2cccc([N+](=O)[O-])c2)SC1=S |
| InChI | InChI=1S/C14H11N3O6S2/c15-11(18)6-9(13(20)21)16-12(19)10(25-14(16)24)5-7-2-1-3-8(4-7)17(22)23/h1-5,9H,6H2,(H2,15,18)(H,20,21)/b10-5- |
| InChIKey | CBDUEGSHNGMMAI-YHYXMXQVSA-N |
| XLogP | 1.12 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|