C19H15ClN2O6S3 — CID 51984264
(2R)-2-[(5Z)-5-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid (PubChem CID 51984264) has the molecular formula C19H15ClN2O6S3 and a molecular weight of 498.99 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(5Z)-5-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 51984264 |
| Molecular Formula | C19H15ClN2O6S3 |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | (2R)-2-[(5Z)-5-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](C(=O)O)N1C(=O)/C(=C/c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)SC1=S |
| InChI | InChI=1S/C19H15ClN2O6S3/c1-30-7-6-14(18(24)25)21-17(23)16(31-19(21)29)9-11-3-5-15(28-11)12-4-2-10(22(26)27)8-13(12)20/h2-5,8-9,14H,6-7H2,1H3,(H,24,25)/b16-9-/t14-/m1/s1 |
| InChIKey | CIJZWPZWCUZQDM-SLVCOGOPSA-N |
| XLogP | 4.92 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|