C26H20Cl2N2O6S2 — CID 126178949
propyl 2-chloro-5-[[2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126178949) has the molecular formula C26H20Cl2N2O6S2 and a molecular weight of 591.49 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126178949 |
| Molecular Formula | C26H20Cl2N2O6S2 |
| Molecular Weight | 591.49 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(Sc4ccc(Cl)cc4)o3)C2=O)ccc1Cl |
| InChI | InChI=1S/C26H20Cl2N2O6S2/c1-2-11-35-25(33)19-12-16(5-9-20(19)28)29-22(31)14-30-24(32)21(38-26(30)34)13-17-6-10-23(36-17)37-18-7-3-15(27)4-8-18/h3-10,12-13H,2,11,14H2,1H3,(H,29,31)/b21-13- |
| InChIKey | FMOLLWADGHTLCI-BKUYFWCQSA-N |
| XLogP | 6.98 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.49 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|