C22H16N2O5S — CID 6371319
methyl 5-[[(5E)-2,4-dioxo-5-[(1-prop-2-ynylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate (PubChem CID 6371319) has the molecular formula C22H16N2O5S and a molecular weight of 420.45 g/mol. Its IUPAC name is methyl 5-[[(5E)-2,4-dioxo-5-[(1-prop-2-ynylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(5E)-2,4-dioxo-5-[(1-prop-2-ynylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 6371319 |
| Molecular Formula | C22H16N2O5S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | methyl 5-[[(5E)-2,4-dioxo-5-[(1-prop-2-ynylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]methyl]furan-2-carboxylate |
| SMILES | C#CCn1cc(/C=C2/SC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C22H16N2O5S/c1-3-10-23-12-14(16-6-4-5-7-17(16)23)11-19-20(25)24(22(27)30-19)13-15-8-9-18(29-15)21(26)28-2/h1,4-9,11-12H,10,13H2,2H3/b19-11+ |
| InChIKey | WJOHWAVVNYIKTA-YBFXNURJSA-N |
| XLogP | 3.89 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|