C27H28BrN3O5S — CID 126382376
(5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126382376) has the molecular formula C27H28BrN3O5S and a molecular weight of 586.51 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126382376 |
| Molecular Formula | C27H28BrN3O5S |
| Molecular Weight | 586.51 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C(COc1ccc(/C=C2\S/C(=N\c3ccccc3)N(C[C@H]3CCCO3)C2=O)cc1Br)N1CCOCC1 |
| InChI | InChI=1S/C27H28BrN3O5S/c28-22-15-19(8-9-23(22)36-18-25(32)30-10-13-34-14-11-30)16-24-26(33)31(17-21-7-4-12-35-21)27(37-24)29-20-5-2-1-3-6-20/h1-3,5-6,8-9,15-16,21H,4,7,10-14,17-18H2/b24-16-,29-27-/t21-/m1/s1 |
| InChIKey | JWQRRXXAIUEANL-SOFSDUETSA-N |
| XLogP | 4.47 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|