C23H23BrN2O4S — CID 126063271
4-[[(5E)-5-[(3-bromo-4-butoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid (PubChem CID 126063271) has the molecular formula C23H23BrN2O4S and a molecular weight of 503.42 g/mol. Its IUPAC name is 4-[[(5E)-5-[(3-bromo-4-butoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[(5E)-5-[(3-bromo-4-butoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 126063271 |
| Molecular Formula | C23H23BrN2O4S |
| Molecular Weight | 503.42 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 4-[[(5E)-5-[(3-bromo-4-butoxyphenyl)methylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoic acid |
| SMILES | CCCCOc1ccc(/C=C2/S/C(=N\c3ccc(C(=O)O)cc3)N(CC)C2=O)cc1Br |
| InChI | InChI=1S/C23H23BrN2O4S/c1-3-5-12-30-19-11-6-15(13-18(19)24)14-20-21(27)26(4-2)23(31-20)25-17-9-7-16(8-10-17)22(28)29/h6-11,13-14H,3-5,12H2,1-2H3,(H,28,29)/b20-14+,25-23- |
| InChIKey | OZACNLKVKOGQID-SQJAOTTLSA-N |
| XLogP | 5.95 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|