C31H31FN4OS — CID 50869743
(5E)-5-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 50869743) has the molecular formula C31H31FN4OS and a molecular weight of 526.68 g/mol. Its IUPAC name is (5E)-5-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50869743 |
| Molecular Formula | C31H31FN4OS |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (5E)-5-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CCCN1c2cc(F)c(/C=C3/S/C(=N\c4ccccc4)N(Cc4cccnc4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C31H31FN4OS/c1-5-14-36-27-17-26(32)23(15-25(27)21(2)18-31(36,3)4)16-28-29(37)35(20-22-10-9-13-33-19-22)30(38-28)34-24-11-7-6-8-12-24/h6-13,15-19H,5,14,20H2,1-4H3/b28-16+,34-30- |
| InChIKey | QEJGUINGEMWSKX-IUMOSKHGSA-N |
| XLogP | 7.44 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|