C25H22FN3O3S — CID 135416737
methyl 3-[3-[[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate (PubChem CID 135416737) has the molecular formula C25H22FN3O3S and a molecular weight of 463.53 g/mol. Its IUPAC name is methyl 3-[3-[[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate.
| Compound Name | methyl 3-[3-[[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 135416737 |
| Molecular Formula | C25H22FN3O3S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | methyl 3-[3-[[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(-n2c(C)cc(C=C3S/C(=N\c4ccc(F)cc4)NC3=O)c2C)c1C |
| InChI | InChI=1S/C25H22FN3O3S/c1-14-12-17(16(3)29(14)21-7-5-6-20(15(21)2)24(31)32-4)13-22-23(30)28-25(33-22)27-19-10-8-18(26)9-11-19/h5-13H,1-4H3,(H,27,28,30) |
| InChIKey | QIEJIWNMDMHTJL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|