C20H22FN3OS — CID 137051179
(5E)-5-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137051179) has the molecular formula C20H22FN3OS and a molecular weight of 371.48 g/mol. Its IUPAC name is (5E)-5-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137051179 |
| Molecular Formula | C20H22FN3OS |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (5E)-5-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2/S/C(=N/c3ccc(F)cc3)NC2=O)c(C)n1C(C)(C)C |
| InChI | InChI=1S/C20H22FN3OS/c1-12-10-14(13(2)24(12)20(3,4)5)11-17-18(25)23-19(26-17)22-16-8-6-15(21)7-9-16/h6-11H,1-5H3,(H,22,23,25)/b17-11+ |
| InChIKey | YOKHCCONCXNPIX-GZTJUZNOSA-N |
| XLogP | 4.89 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|