C21H25N3O2S — CID 137080429
(5E)-5-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137080429) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is (5E)-5-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137080429 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (5E)-5-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\NC(=O)/C(=C\c3cc(C)n(C(C)(C)C)c3C)S2)cc1 |
| InChI | InChI=1S/C21H25N3O2S/c1-13-11-15(14(2)24(13)21(3,4)5)12-18-19(25)23-20(27-18)22-16-7-9-17(26-6)10-8-16/h7-12H,1-6H3,(H,22,23,25)/b18-12+ |
| InChIKey | FXYZEZLKPWJDTH-LDADJPATSA-N |
| XLogP | 4.76 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|