C23H19Cl2N3O2S — CID 137080537
(5E)-5-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137080537) has the molecular formula C23H19Cl2N3O2S and a molecular weight of 472.40 g/mol. Its IUPAC name is (5E)-5-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137080537 |
| Molecular Formula | C23H19Cl2N3O2S |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | (5E)-5-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2/NC(=O)/C(=C\c3cc(C)n(-c4ccc(Cl)cc4Cl)c3C)S2)cc1 |
| InChI | InChI=1S/C23H19Cl2N3O2S/c1-13-10-15(14(2)28(13)20-9-4-16(24)12-19(20)25)11-21-22(29)27-23(31-21)26-17-5-7-18(30-3)8-6-17/h4-12H,1-3H3,(H,26,27,29)/b21-11+ |
| InChIKey | SAYALCUVNYGFGZ-SRZZPIQSSA-N |
| XLogP | 6.30 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|