C24H21Cl2N3OS — CID 137044189
(5Z)-5-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137044189) has the molecular formula C24H21Cl2N3OS and a molecular weight of 470.43 g/mol. Its IUPAC name is (5Z)-5-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137044189 |
| Molecular Formula | C24H21Cl2N3OS |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | (5Z)-5-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-(4-ethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(/N=C2\NC(=O)/C(=C/c3cc(C)n(-c4cc(Cl)ccc4Cl)c3C)S2)cc1 |
| InChI | InChI=1S/C24H21Cl2N3OS/c1-4-16-5-8-19(9-6-16)27-24-28-23(30)22(31-24)12-17-11-14(2)29(15(17)3)21-13-18(25)7-10-20(21)26/h5-13H,4H2,1-3H3,(H,27,28,30)/b22-12- |
| InChIKey | ZQCJSQQXNWWXFC-UUYOSTAYSA-N |
| XLogP | 6.85 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|