C17H16BrN3OS — CID 137044561
(5Z)-2-(4-bromophenyl)imino-5-[(1,2,5-trimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137044561) has the molecular formula C17H16BrN3OS and a molecular weight of 390.31 g/mol. Its IUPAC name is (5Z)-2-(4-bromophenyl)imino-5-[(1,2,5-trimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-bromophenyl)imino-5-[(1,2,5-trimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137044561 |
| Molecular Formula | C17H16BrN3OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | (5Z)-2-(4-bromophenyl)imino-5-[(1,2,5-trimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=C2\S/C(=N/c3ccc(Br)cc3)NC2=O)c(C)n1C |
| InChI | InChI=1S/C17H16BrN3OS/c1-10-8-12(11(2)21(10)3)9-15-16(22)20-17(23-15)19-14-6-4-13(18)5-7-14/h4-9H,1-3H3,(H,19,20,22)/b15-9- |
| InChIKey | DPHVOFGOUBHJRE-DHDCSXOGSA-N |
| XLogP | 4.30 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|