C19H14BrN3OS — CID 135529219
(5E)-2-(4-bromophenyl)imino-5-[(1-methylindol-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135529219) has the molecular formula C19H14BrN3OS and a molecular weight of 412.31 g/mol. Its IUPAC name is (5E)-2-(4-bromophenyl)imino-5-[(1-methylindol-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-bromophenyl)imino-5-[(1-methylindol-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135529219 |
| Molecular Formula | C19H14BrN3OS |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | (5E)-2-(4-bromophenyl)imino-5-[(1-methylindol-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cn1c(/C=C2/S/C(=N\c3ccc(Br)cc3)NC2=O)cc2ccccc21 |
| InChI | InChI=1S/C19H14BrN3OS/c1-23-15(10-12-4-2-3-5-16(12)23)11-17-18(24)22-19(25-17)21-14-8-6-13(20)7-9-14/h2-11H,1H3,(H,21,22,24)/b17-11+ |
| InChIKey | XOOCESDEHKDLDB-GZTJUZNOSA-N |
| XLogP | 4.83 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|