C27H27N3O4S — CID 137138985
methyl 4-[3-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate (PubChem CID 137138985) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is methyl 4-[3-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[3-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 137138985 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | methyl 4-[3-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-3-methylbenzoate |
| SMILES | CCOc1ccc(/N=C2/NC(=O)/C(=C\c3cc(C)n(-c4ccc(C(=O)OC)cc4C)c3C)S2)cc1 |
| InChI | InChI=1S/C27H27N3O4S/c1-6-34-22-10-8-21(9-11-22)28-27-29-25(31)24(35-27)15-20-14-17(3)30(18(20)4)23-12-7-19(13-16(23)2)26(32)33-5/h7-15H,6H2,1-5H3,(H,28,29,31)/b24-15+ |
| InChIKey | AENKEHUQBBYOJJ-BUVRLJJBSA-N |
| XLogP | 5.48 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|