C20H16F7N3 — CID 126037499
N-[(E)-(2,5-dimethyl-1-naphthalen-2-ylpyrrol-3-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126037499) has the molecular formula C20H16F7N3 and a molecular weight of 431.36 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethyl-1-naphthalen-2-ylpyrrol-3-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-(2,5-dimethyl-1-naphthalen-2-ylpyrrol-3-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126037499 |
| Molecular Formula | C20H16F7N3 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[(E)-(2,5-dimethyl-1-naphthalen-2-ylpyrrol-3-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | Cc1cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)c(C)n1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H16F7N3/c1-12-9-16(11-28-29-20(26,27)18(21,22)19(23,24)25)13(2)30(12)17-8-7-14-5-3-4-6-15(14)10-17/h3-11,29H,1-2H3/b28-11+ |
| InChIKey | GGTCEHNJJPRFGG-IPBVOBEMSA-N |
| XLogP | 5.96 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|