C23H27F3N4O3 — CID 4689630
1-(2,6-dimethylpiperidin-1-yl)-2-[2-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]ethanone (PubChem CID 4689630) has the molecular formula C23H27F3N4O3 and a molecular weight of 464.49 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperidin-1-yl)-2-[2-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]ethanone.
| Compound Name | 1-(2,6-dimethylpiperidin-1-yl)-2-[2-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]ethanone |
|---|---|
| PubChem CID | 4689630 |
| Molecular Formula | C23H27F3N4O3 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-(2,6-dimethylpiperidin-1-yl)-2-[2-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]ethanone |
| SMILES | COc1cc(C=NNc2ccc(C(F)(F)F)cn2)ccc1OCC(=O)N1C(C)CCCC1C |
| InChI | InChI=1S/C23H27F3N4O3/c1-15-5-4-6-16(2)30(15)22(31)14-33-19-9-7-17(11-20(19)32-3)12-28-29-21-10-8-18(13-27-21)23(24,25)26/h7-13,15-16H,4-6,14H2,1-3H3,(H,27,29) |
| InChIKey | GHLGPUAORZUROG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|