C24H29N5O3 — CID 5171925
2-[4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]-2-methoxyphenoxy]-1-(2,6-dimethylpiperidin-1-yl)ethanone (PubChem CID 5171925) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]-2-methoxyphenoxy]-1-(2,6-dimethylpiperidin-1-yl)ethanone.
| Compound Name | 2-[4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]-2-methoxyphenoxy]-1-(2,6-dimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 5171925 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-[4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]-2-methoxyphenoxy]-1-(2,6-dimethylpiperidin-1-yl)ethanone |
| SMILES | COc1cc(C=NNc2nc3ccccc3[nH]2)ccc1OCC(=O)N1C(C)CCCC1C |
| InChI | InChI=1S/C24H29N5O3/c1-16-7-6-8-17(2)29(16)23(30)15-32-21-12-11-18(13-22(21)31-3)14-25-28-24-26-19-9-4-5-10-20(19)27-24/h4-5,9-14,16-17H,6-8,15H2,1-3H3,(H2,26,27,28) |
| InChIKey | CSKLRSPQDOUQQU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|