C6H6Cl3N3O2 — CID 141488652
(4,5-dichloro-2-nitrophenyl)hydrazine;hydrochloride (PubChem CID 141488652) has the molecular formula C6H6Cl3N3O2 and a molecular weight of 258.49 g/mol. Its IUPAC name is (4,5-dichloro-2-nitrophenyl)hydrazine;hydrochloride.
| Compound Name | (4,5-dichloro-2-nitrophenyl)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 141488652 |
| Molecular Formula | C6H6Cl3N3O2 |
| Molecular Weight | 258.49 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | (4,5-dichloro-2-nitrophenyl)hydrazine;hydrochloride |
| SMILES | Cl.NNc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5Cl2N3O2.ClH/c7-3-1-5(10-9)6(11(12)13)2-4(3)8;/h1-2,10H,9H2;1H |
| InChIKey | BUZOYSLDMIFVQT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|