C12H16Cl2N2O2 — CID 104828628
4,5-dichloro-N-(3,3-dimethylbutan-2-yl)-2-nitroaniline (PubChem CID 104828628) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 4,5-dichloro-N-(3,3-dimethylbutan-2-yl)-2-nitroaniline.
| Compound Name | 4,5-dichloro-N-(3,3-dimethylbutan-2-yl)-2-nitroaniline |
|---|---|
| PubChem CID | 104828628 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4,5-dichloro-N-(3,3-dimethylbutan-2-yl)-2-nitroaniline |
| SMILES | CC(Nc1cc(Cl)c(Cl)cc1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C12H16Cl2N2O2/c1-7(12(2,3)4)15-10-5-8(13)9(14)6-11(10)16(17)18/h5-7,15H,1-4H3 |
| InChIKey | FHARPDWYUUKOMF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|