C8H7ClF3N3O2 — CID 90176718
2-chloro-5-nitro-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyridin-4-amine (PubChem CID 90176718) has the molecular formula C8H7ClF3N3O2 and a molecular weight of 269.61 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyridin-4-amine.
| Compound Name | 2-chloro-5-nitro-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 90176718 |
| Molecular Formula | C8H7ClF3N3O2 |
| Molecular Weight | 269.61 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 2-chloro-5-nitro-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyridin-4-amine |
| SMILES | C[C@H](Nc1cc(Cl)ncc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C8H7ClF3N3O2/c1-4(8(10,11)12)14-5-2-7(9)13-3-6(5)15(16)17/h2-4H,1H3,(H,13,14)/t4-/m0/s1 |
| InChIKey | UCKVQRQTQMHADV-BYPYZUCNSA-N |
| XLogP | 3.01 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|