C9H11ClN4O3 — CID 141369480
2-[(2-chloro-5-nitro-4-pyridinyl)amino]-N,N-dimethylacetamide (PubChem CID 141369480) has the molecular formula C9H11ClN4O3 and a molecular weight of 258.67 g/mol. Its IUPAC name is 2-[(2-chloro-5-nitro-4-pyridinyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[(2-chloro-5-nitro-4-pyridinyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 141369480 |
| Molecular Formula | C9H11ClN4O3 |
| Molecular Weight | 258.67 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-[(2-chloro-5-nitro-4-pyridinyl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11ClN4O3/c1-13(2)9(15)5-11-6-3-8(10)12-4-7(6)14(16)17/h3-4H,5H2,1-2H3,(H,11,12) |
| InChIKey | UDLWAAWEYZSAKU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.67 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|