C17H15ClF3N5O2 — CID 170707636
2-chloro-N-[[4-[1-methyl-4-(trifluoromethyl)-4,5-dihydroimidazol-2-yl]phenyl]methyl]-5-nitropyridin-4-amine (PubChem CID 170707636) has the molecular formula C17H15ClF3N5O2 and a molecular weight of 413.79 g/mol. Its IUPAC name is 2-chloro-N-[[4-[1-methyl-4-(trifluoromethyl)-4,5-dihydroimidazol-2-yl]phenyl]methyl]-5-nitropyridin-4-amine.
| Compound Name | 2-chloro-N-[[4-[1-methyl-4-(trifluoromethyl)-4,5-dihydroimidazol-2-yl]phenyl]methyl]-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 170707636 |
| Molecular Formula | C17H15ClF3N5O2 |
| Molecular Weight | 413.79 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-chloro-N-[[4-[1-methyl-4-(trifluoromethyl)-4,5-dihydroimidazol-2-yl]phenyl]methyl]-5-nitropyridin-4-amine |
| SMILES | CN1CC(C(F)(F)F)N=C1c1ccc(CNc2cc(Cl)ncc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15ClF3N5O2/c1-25-9-14(17(19,20)21)24-16(25)11-4-2-10(3-5-11)7-22-12-6-15(18)23-8-13(12)26(27)28/h2-6,8,14H,7,9H2,1H3,(H,22,23) |
| InChIKey | UPOFGVWDUDTNON-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|