C11H9F3N4O3 — CID 106749195
N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitro-2-(trifluoromethyl)pyridin-4-amine (PubChem CID 106749195) has the molecular formula C11H9F3N4O3 and a molecular weight of 302.21 g/mol. Its IUPAC name is N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitro-2-(trifluoromethyl)pyridin-4-amine.
| Compound Name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 106749195 |
| Molecular Formula | C11H9F3N4O3 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
| SMILES | Cc1cc(CNc2cc(C(F)(F)F)ncc2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C11H9F3N4O3/c1-6-2-7(17-21-6)4-15-8-3-10(11(12,13)14)16-5-9(8)18(19)20/h2-3,5H,4H2,1H3,(H,15,16) |
| InChIKey | MZEPNEHWMBWPAG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|