C13H18Cl2N2O3 — CID 106255327
2-[(4,5-dichloro-2-nitroanilino)methyl]-2-ethylbutan-1-ol (PubChem CID 106255327) has the molecular formula C13H18Cl2N2O3 and a molecular weight of 321.20 g/mol. Its IUPAC name is 2-[(4,5-dichloro-2-nitroanilino)methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[(4,5-dichloro-2-nitroanilino)methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 106255327 |
| Molecular Formula | C13H18Cl2N2O3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[(4,5-dichloro-2-nitroanilino)methyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)CNc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18Cl2N2O3/c1-3-13(4-2,8-18)7-16-11-5-9(14)10(15)6-12(11)17(19)20/h5-6,16,18H,3-4,7-8H2,1-2H3 |
| InChIKey | FTWDXXWXAXZAPO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|