About CID 59529888
CID 59529888 (PubChem CID 59529888) has the molecular formula C8H7BClN3O3
and a molecular weight of 239.43 g/mol.
Molecular Properties
| Compound Name | CID 59529888 |
| PubChem CID | 59529888 |
| Molecular Formula | C8H7BClN3O3 |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | — |
| SMILES | [B]C(=O)Nc1cc(NC)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C8H7BClN3O3/c1-11-6-3-5(12-8(9)14)4(10)2-7(6)13(15)16/h2-3,11H,1H3,(H,12,14) |
| InChIKey | HRJPHVFAEUKZCS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 59529888 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59529888?
The IUPAC name of CID 59529888 (CID 59529888) is not available.
What is the SMILES notation for CID 59529888?
The canonical SMILES for CID 59529888 is [B]C(=O)Nc1cc(NC)c([N+](=O)[O-])cc1Cl.
What is the InChIKey of CID 59529888?
The InChIKey is HRJPHVFAEUKZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BClN3O3/c1-11-6-3-5(12-8(9)14)4(10)2-7(6)13(15)16/h2-3,11H,1H3,(H,12,14).
What are the key properties of CID 59529888?
CID 59529888 has a molecular weight of 239.43 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59529888 is sourced from PubChem (CID 59529888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).