C11H11Cl2N5O2 — CID 80688696
4,5-dichloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-2-nitroaniline (PubChem CID 80688696) has the molecular formula C11H11Cl2N5O2 and a molecular weight of 316.15 g/mol. Its IUPAC name is 4,5-dichloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-2-nitroaniline.
| Compound Name | 4,5-dichloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 80688696 |
| Molecular Formula | C11H11Cl2N5O2 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4,5-dichloro-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]-2-nitroaniline |
| SMILES | Cn1cnc(CCNc2cc(Cl)c(Cl)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H11Cl2N5O2/c1-17-6-15-11(16-17)2-3-14-9-4-7(12)8(13)5-10(9)18(19)20/h4-6,14H,2-3H2,1H3 |
| InChIKey | LNJIXBARIHDFNQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|