C12H14N4O8 — CID 22253792
2,3,4,5-tetrahydroxy-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal (PubChem CID 22253792) has the molecular formula C12H14N4O8 and a molecular weight of 342.26 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxy-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal.
| Compound Name | 2,3,4,5-tetrahydroxy-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal |
|---|---|
| PubChem CID | 22253792 |
| Molecular Formula | C12H14N4O8 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2,3,4,5-tetrahydroxy-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal |
| SMILES | O=CC(O)C(O)C(O)C(O)CNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C12H14N4O8/c17-4-8(19)12(21)11(20)7(18)3-13-5-1-2-6(16(22)23)10-9(5)14-24-15-10/h1-2,4,7-8,11-13,18-21H,3H2 |
| InChIKey | DEPMSUUWSGUYKQ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 192.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|